C14H19Cl3N2O2 — CID 103387727
tert-butyl N-[2-(2,4,6-trichloroanilino)propyl]carbamate (PubChem CID 103387727) has the molecular formula C14H19Cl3N2O2 and a molecular weight of 353.68 g/mol. Its IUPAC name is tert-butyl N-[2-(2,4,6-trichloroanilino)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(2,4,6-trichloroanilino)propyl]carbamate |
|---|---|
| PubChem CID | 103387727 |
| Molecular Formula | C14H19Cl3N2O2 |
| Molecular Weight | 353.68 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | tert-butyl N-[2-(2,4,6-trichloroanilino)propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl3N2O2/c1-8(7-18-13(20)21-14(2,3)4)19-12-10(16)5-9(15)6-11(12)17/h5-6,8,19H,7H2,1-4H3,(H,18,20) |
| InChIKey | LMBQMBCBZMJKOP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |