C15H20F4N2O2 — CID 103389891
tert-butyl N-[2-[2-fluoro-5-(trifluoromethyl)anilino]propyl]carbamate (PubChem CID 103389891) has the molecular formula C15H20F4N2O2 and a molecular weight of 336.33 g/mol. Its IUPAC name is tert-butyl N-[2-[2-fluoro-5-(trifluoromethyl)anilino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-fluoro-5-(trifluoromethyl)anilino]propyl]carbamate |
|---|---|
| PubChem CID | 103389891 |
| Molecular Formula | C15H20F4N2O2 |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | tert-butyl N-[2-[2-fluoro-5-(trifluoromethyl)anilino]propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)Nc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C15H20F4N2O2/c1-9(8-20-13(22)23-14(2,3)4)21-12-7-10(15(17,18)19)5-6-11(12)16/h5-7,9,21H,8H2,1-4H3,(H,20,22) |
| InChIKey | FRCBKCZEWNQYQE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |