C11H13F4NO — CID 55144774
2-fluoro-N-(1-methoxypropan-2-yl)-5-(trifluoromethyl)aniline (PubChem CID 55144774) has the molecular formula C11H13F4NO and a molecular weight of 251.22 g/mol. Its IUPAC name is 2-fluoro-N-(1-methoxypropan-2-yl)-5-(trifluoromethyl)aniline.
| Compound Name | 2-fluoro-N-(1-methoxypropan-2-yl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 55144774 |
| Molecular Formula | C11H13F4NO |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-fluoro-N-(1-methoxypropan-2-yl)-5-(trifluoromethyl)aniline |
| SMILES | COCC(C)Nc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C11H13F4NO/c1-7(6-17-2)16-10-5-8(11(13,14)15)3-4-9(10)12/h3-5,7,16H,6H2,1-2H3 |
| InChIKey | ZDSDWIOGEFDRFV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |