C13H15F4N — CID 55193729
2-fluoro-N-[1-(1-methylcyclopropyl)ethyl]-5-(trifluoromethyl)aniline (PubChem CID 55193729) has the molecular formula C13H15F4N and a molecular weight of 261.26 g/mol. Its IUPAC name is 2-fluoro-N-[1-(1-methylcyclopropyl)ethyl]-5-(trifluoromethyl)aniline.
| Compound Name | 2-fluoro-N-[1-(1-methylcyclopropyl)ethyl]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 55193729 |
| Molecular Formula | C13H15F4N |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-fluoro-N-[1-(1-methylcyclopropyl)ethyl]-5-(trifluoromethyl)aniline |
| SMILES | CC(Nc1cc(C(F)(F)F)ccc1F)C1(C)CC1 |
| InChI | InChI=1S/C13H15F4N/c1-8(12(2)5-6-12)18-11-7-9(13(15,16)17)3-4-10(11)14/h3-4,7-8,18H,5-6H2,1-2H3 |
| InChIKey | RVJYPWUTEMWPJO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |