C11H12F4N2O2 — CID 114242293
methyl 3-amino-2-[2-fluoro-5-(trifluoromethyl)anilino]propanoate (PubChem CID 114242293) has the molecular formula C11H12F4N2O2 and a molecular weight of 280.22 g/mol. Its IUPAC name is methyl 3-amino-2-[2-fluoro-5-(trifluoromethyl)anilino]propanoate.
| Compound Name | methyl 3-amino-2-[2-fluoro-5-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 114242293 |
| Molecular Formula | C11H12F4N2O2 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | methyl 3-amino-2-[2-fluoro-5-(trifluoromethyl)anilino]propanoate |
| SMILES | COC(=O)C(CN)Nc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C11H12F4N2O2/c1-19-10(18)9(5-16)17-8-4-6(11(13,14)15)2-3-7(8)12/h2-4,9,17H,5,16H2,1H3 |
| InChIKey | SMHWSTAQIWQUPA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |