C11H11F4NO3 — CID 107303971
methyl 2-[2-fluoro-4-(trifluoromethyl)anilino]-3-hydroxypropanoate (PubChem CID 107303971) has the molecular formula C11H11F4NO3 and a molecular weight of 281.21 g/mol. Its IUPAC name is methyl 2-[2-fluoro-4-(trifluoromethyl)anilino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[2-fluoro-4-(trifluoromethyl)anilino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 107303971 |
| Molecular Formula | C11H11F4NO3 |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | methyl 2-[2-fluoro-4-(trifluoromethyl)anilino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)Nc1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C11H11F4NO3/c1-19-10(18)9(5-17)16-8-3-2-6(4-7(8)12)11(13,14)15/h2-4,9,16-17H,5H2,1H3 |
| InChIKey | VHMVCZNQWPRHFR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |