C12H11F4N — CID 106231279
2-fluoro-N-pent-1-yn-3-yl-4-(trifluoromethyl)aniline (PubChem CID 106231279) has the molecular formula C12H11F4N and a molecular weight of 245.22 g/mol. Its IUPAC name is 2-fluoro-N-pent-1-yn-3-yl-4-(trifluoromethyl)aniline.
| Compound Name | 2-fluoro-N-pent-1-yn-3-yl-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 106231279 |
| Molecular Formula | C12H11F4N |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2-fluoro-N-pent-1-yn-3-yl-4-(trifluoromethyl)aniline |
| SMILES | C#CC(CC)Nc1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C12H11F4N/c1-3-9(4-2)17-11-6-5-8(7-10(11)13)12(14,15)16/h1,5-7,9,17H,4H2,2H3 |
| InChIKey | XISAYEYKASQCBZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|