C12H14ClF4N — CID 107304160
N-(2-chloropentyl)-2-fluoro-4-(trifluoromethyl)aniline (PubChem CID 107304160) has the molecular formula C12H14ClF4N and a molecular weight of 283.70 g/mol. Its IUPAC name is N-(2-chloropentyl)-2-fluoro-4-(trifluoromethyl)aniline.
| Compound Name | N-(2-chloropentyl)-2-fluoro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107304160 |
| Molecular Formula | C12H14ClF4N |
| Molecular Weight | 283.70 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-(2-chloropentyl)-2-fluoro-4-(trifluoromethyl)aniline |
| SMILES | CCCC(Cl)CNc1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C12H14ClF4N/c1-2-3-9(13)7-18-11-5-4-8(6-10(11)14)12(15,16)17/h4-6,9,18H,2-3,7H2,1H3 |
| InChIKey | PXWPGVMVRPCEQV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.70 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|