C14H19F4NS — CID 129162276
2-fluoro-N-(hexylsulfanylmethyl)-4-(trifluoromethyl)aniline (PubChem CID 129162276) has the molecular formula C14H19F4NS and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-fluoro-N-(hexylsulfanylmethyl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-fluoro-N-(hexylsulfanylmethyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 129162276 |
| Molecular Formula | C14H19F4NS |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-fluoro-N-(hexylsulfanylmethyl)-4-(trifluoromethyl)aniline |
| SMILES | CCCCCCSCNc1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C14H19F4NS/c1-2-3-4-5-8-20-10-19-13-7-6-11(9-12(13)15)14(16,17)18/h6-7,9,19H,2-5,8,10H2,1H3 |
| InChIKey | HJKJUQXTJAUZAY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|