C15H23F2N — CID 43129325
2,4-difluoro-N-nonylaniline (PubChem CID 43129325) has the molecular formula C15H23F2N and a molecular weight of 255.35 g/mol. Its IUPAC name is 2,4-difluoro-N-nonylaniline.
| Compound Name | 2,4-difluoro-N-nonylaniline |
|---|---|
| PubChem CID | 43129325 |
| Molecular Formula | C15H23F2N |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 2,4-difluoro-N-nonylaniline |
| SMILES | CCCCCCCCCNc1ccc(F)cc1F |
| InChI | InChI=1S/C15H23F2N/c1-2-3-4-5-6-7-8-11-18-15-10-9-13(16)12-14(15)17/h9-10,12,18H,2-8,11H2,1H3 |
| InChIKey | QZVPGCDJIZAIIC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|