About 4-fluoro-N-heptylaniline
4-fluoro-N-heptylaniline (PubChem CID 43129312) has the molecular formula C13H20FN
and a molecular weight of 209.31 g/mol. Its IUPAC name is 4-fluoro-N-heptylaniline.
Molecular Properties
| Compound Name | 4-fluoro-N-heptylaniline |
| PubChem CID | 43129312 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 4-fluoro-N-heptylaniline |
| SMILES | CCCCCCCNc1ccc(F)cc1 |
| InChI | InChI=1S/C13H20FN/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10,15H,2-6,11H2,1H3 |
| InChIKey | YLALJMNOAVKWIJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-N-heptylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-heptylaniline?
The IUPAC name of 4-fluoro-N-heptylaniline (CID 43129312) is 4-fluoro-N-heptylaniline.
What is the SMILES notation for 4-fluoro-N-heptylaniline?
The canonical SMILES for 4-fluoro-N-heptylaniline is CCCCCCCNc1ccc(F)cc1.
What is the InChIKey of 4-fluoro-N-heptylaniline?
The InChIKey is YLALJMNOAVKWIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20FN/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10,15H,2-6,11H2,1H3.
What are the key properties of 4-fluoro-N-heptylaniline?
4-fluoro-N-heptylaniline has a molecular weight of 209.31 g/mol, XLogP of 4.21, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-heptylaniline is sourced from PubChem (CID 43129312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).