About 4-methyl-N-octylaniline
4-methyl-N-octylaniline (PubChem CID 11816856) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is 4-methyl-N-octylaniline.
Molecular Properties
| Compound Name | 4-methyl-N-octylaniline |
| PubChem CID | 11816856 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 4-methyl-N-octylaniline |
| SMILES | CCCCCCCCNc1ccc(C)cc1 |
| InChI | InChI=1S/C15H25N/c1-3-4-5-6-7-8-13-16-15-11-9-14(2)10-12-15/h9-12,16H,3-8,13H2,1-2H3 |
| InChIKey | HMWJFEAMVBDZGJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N-octylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-octylaniline?
The IUPAC name of 4-methyl-N-octylaniline (CID 11816856) is 4-methyl-N-octylaniline.
What is the SMILES notation for 4-methyl-N-octylaniline?
The canonical SMILES for 4-methyl-N-octylaniline is CCCCCCCCNc1ccc(C)cc1.
What is the InChIKey of 4-methyl-N-octylaniline?
The InChIKey is HMWJFEAMVBDZGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N/c1-3-4-5-6-7-8-13-16-15-11-9-14(2)10-12-15/h9-12,16H,3-8,13H2,1-2H3.
What are the key properties of 4-methyl-N-octylaniline?
4-methyl-N-octylaniline has a molecular weight of 219.37 g/mol, XLogP of 4.77, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-octylaniline is sourced from PubChem (CID 11816856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).