C15H25N — CID 43129292
N-heptyl-3,4-dimethylaniline (PubChem CID 43129292) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-heptyl-3,4-dimethylaniline.
| Compound Name | N-heptyl-3,4-dimethylaniline |
|---|---|
| PubChem CID | 43129292 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-heptyl-3,4-dimethylaniline |
| SMILES | CCCCCCCNc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H25N/c1-4-5-6-7-8-11-16-15-10-9-13(2)14(3)12-15/h9-10,12,16H,4-8,11H2,1-3H3 |
| InChIKey | FUDQEKPWWMDYQJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|