C16H28N2 — CID 19708209
1-N,3-N-dipentylbenzene-1,3-diamine (PubChem CID 19708209) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-N,3-N-dipentylbenzene-1,3-diamine.
| Compound Name | 1-N,3-N-dipentylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 19708209 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 1-N,3-N-dipentylbenzene-1,3-diamine |
| SMILES | CCCCCNc1cccc(NCCCCC)c1 |
| InChI | InChI=1S/C16H28N2/c1-3-5-7-12-17-15-10-9-11-16(14-15)18-13-8-6-4-2/h9-11,14,17-18H,3-8,12-13H2,1-2H3 |
| InChIKey | SUMMCMFBTZDZDJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|