About 3-butoxy-N-octylaniline
3-butoxy-N-octylaniline (PubChem CID 54800685) has the molecular formula C18H31NO
and a molecular weight of 277.45 g/mol. Its IUPAC name is 3-butoxy-N-octylaniline.
Molecular Properties
| Compound Name | 3-butoxy-N-octylaniline |
| PubChem CID | 54800685 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 3-butoxy-N-octylaniline |
| SMILES | CCCCCCCCNc1cccc(OCCCC)c1 |
| InChI | InChI=1S/C18H31NO/c1-3-5-7-8-9-10-14-19-17-12-11-13-18(16-17)20-15-6-4-2/h11-13,16,19H,3-10,14-15H2,1-2H3 |
| InChIKey | CSOJOKNONBAQEF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-N-octylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-N-octylaniline?
The IUPAC name of 3-butoxy-N-octylaniline (CID 54800685) is 3-butoxy-N-octylaniline.
What is the SMILES notation for 3-butoxy-N-octylaniline?
The canonical SMILES for 3-butoxy-N-octylaniline is CCCCCCCCNc1cccc(OCCCC)c1.
What is the InChIKey of 3-butoxy-N-octylaniline?
The InChIKey is CSOJOKNONBAQEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO/c1-3-5-7-8-9-10-14-19-17-12-11-13-18(16-17)20-15-6-4-2/h11-13,16,19H,3-10,14-15H2,1-2H3.
What are the key properties of 3-butoxy-N-octylaniline?
3-butoxy-N-octylaniline has a molecular weight of 277.45 g/mol, XLogP of 5.64, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-N-octylaniline is sourced from PubChem (CID 54800685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).