C23H34N2O2 — CID 54808553
N'-(3-hexoxyphenyl)-N-(4-propan-2-yloxyphenyl)ethane-1,2-diamine (PubChem CID 54808553) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is N'-(3-hexoxyphenyl)-N-(4-propan-2-yloxyphenyl)ethane-1,2-diamine.
| Compound Name | N'-(3-hexoxyphenyl)-N-(4-propan-2-yloxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54808553 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | N'-(3-hexoxyphenyl)-N-(4-propan-2-yloxyphenyl)ethane-1,2-diamine |
| SMILES | CCCCCCOc1cccc(NCCNc2ccc(OC(C)C)cc2)c1 |
| InChI | InChI=1S/C23H34N2O2/c1-4-5-6-7-17-26-23-10-8-9-21(18-23)25-16-15-24-20-11-13-22(14-12-20)27-19(2)3/h8-14,18-19,24-25H,4-7,15-17H2,1-3H3 |
| InChIKey | JCHPKBLIRRYPST-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|