C25H38N2O2 — CID 54808048
N'-(3-heptoxyphenyl)-N-[(4-propan-2-yloxyphenyl)methyl]ethane-1,2-diamine (PubChem CID 54808048) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is N'-(3-heptoxyphenyl)-N-[(4-propan-2-yloxyphenyl)methyl]ethane-1,2-diamine.
| Compound Name | N'-(3-heptoxyphenyl)-N-[(4-propan-2-yloxyphenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 54808048 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | N'-(3-heptoxyphenyl)-N-[(4-propan-2-yloxyphenyl)methyl]ethane-1,2-diamine |
| SMILES | CCCCCCCOc1cccc(NCCNCc2ccc(OC(C)C)cc2)c1 |
| InChI | InChI=1S/C25H38N2O2/c1-4-5-6-7-8-18-28-25-11-9-10-23(19-25)27-17-16-26-20-22-12-14-24(15-13-22)29-21(2)3/h9-15,19,21,26-27H,4-8,16-18,20H2,1-3H3 |
| InChIKey | LBWBXWMMJIQNFB-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|