About 3-bromo-N-octylaniline
3-bromo-N-octylaniline (PubChem CID 43129310) has the molecular formula C14H22BrN
and a molecular weight of 284.24 g/mol. Its IUPAC name is 3-bromo-N-octylaniline.
Molecular Properties
| Compound Name | 3-bromo-N-octylaniline |
| PubChem CID | 43129310 |
| Molecular Formula | C14H22BrN |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 3-bromo-N-octylaniline |
| SMILES | CCCCCCCCNc1cccc(Br)c1 |
| InChI | InChI=1S/C14H22BrN/c1-2-3-4-5-6-7-11-16-14-10-8-9-13(15)12-14/h8-10,12,16H,2-7,11H2,1H3 |
| InChIKey | UNCBRYPNACHVPQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N-octylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-octylaniline?
The IUPAC name of 3-bromo-N-octylaniline (CID 43129310) is 3-bromo-N-octylaniline.
What is the SMILES notation for 3-bromo-N-octylaniline?
The canonical SMILES for 3-bromo-N-octylaniline is CCCCCCCCNc1cccc(Br)c1.
What is the InChIKey of 3-bromo-N-octylaniline?
The InChIKey is UNCBRYPNACHVPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22BrN/c1-2-3-4-5-6-7-11-16-14-10-8-9-13(15)12-14/h8-10,12,16H,2-7,11H2,1H3.
What are the key properties of 3-bromo-N-octylaniline?
3-bromo-N-octylaniline has a molecular weight of 284.24 g/mol, XLogP of 5.22, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-octylaniline is sourced from PubChem (CID 43129310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).