C17H28BrN — CID 107573583
4-bromo-3,5-dimethyl-N-nonylaniline (PubChem CID 107573583) has the molecular formula C17H28BrN and a molecular weight of 326.32 g/mol. Its IUPAC name is 4-bromo-3,5-dimethyl-N-nonylaniline.
| Compound Name | 4-bromo-3,5-dimethyl-N-nonylaniline |
|---|---|
| PubChem CID | 107573583 |
| Molecular Formula | C17H28BrN |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 4-bromo-3,5-dimethyl-N-nonylaniline |
| SMILES | CCCCCCCCCNc1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C17H28BrN/c1-4-5-6-7-8-9-10-11-19-16-12-14(2)17(18)15(3)13-16/h12-13,19H,4-11H2,1-3H3 |
| InChIKey | YGGJYYPVRIYOEJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|