C13H20BrNO2S — CID 107573637
4-bromo-3,5-dimethyl-N-(2-propylsulfonylethyl)aniline (PubChem CID 107573637) has the molecular formula C13H20BrNO2S and a molecular weight of 334.28 g/mol. Its IUPAC name is 4-bromo-3,5-dimethyl-N-(2-propylsulfonylethyl)aniline.
| Compound Name | 4-bromo-3,5-dimethyl-N-(2-propylsulfonylethyl)aniline |
|---|---|
| PubChem CID | 107573637 |
| Molecular Formula | C13H20BrNO2S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 4-bromo-3,5-dimethyl-N-(2-propylsulfonylethyl)aniline |
| SMILES | CCCS(=O)(=O)CCNc1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C13H20BrNO2S/c1-4-6-18(16,17)7-5-15-12-8-10(2)13(14)11(3)9-12/h8-9,15H,4-7H2,1-3H3 |
| InChIKey | VKHZUCIADHQJGK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |