C11H15Br2NO2S — CID 107599018
2,6-dibromo-N-(2-propylsulfonylethyl)aniline (PubChem CID 107599018) has the molecular formula C11H15Br2NO2S and a molecular weight of 385.12 g/mol. Its IUPAC name is 2,6-dibromo-N-(2-propylsulfonylethyl)aniline.
| Compound Name | 2,6-dibromo-N-(2-propylsulfonylethyl)aniline |
|---|---|
| PubChem CID | 107599018 |
| Molecular Formula | C11H15Br2NO2S |
| Molecular Weight | 385.12 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | 2,6-dibromo-N-(2-propylsulfonylethyl)aniline |
| SMILES | CCCS(=O)(=O)CCNc1c(Br)cccc1Br |
| InChI | InChI=1S/C11H15Br2NO2S/c1-2-7-17(15,16)8-6-14-11-9(12)4-3-5-10(11)13/h3-5,14H,2,6-8H2,1H3 |
| InChIKey | AJPFPLFMNWLKBW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.12 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |