C14H18N2O4S — CID 106722966
2-methyl-5-(2-propylsulfonylethylamino)isoindole-1,3-dione (PubChem CID 106722966) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-methyl-5-(2-propylsulfonylethylamino)isoindole-1,3-dione.
| Compound Name | 2-methyl-5-(2-propylsulfonylethylamino)isoindole-1,3-dione |
|---|---|
| PubChem CID | 106722966 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-methyl-5-(2-propylsulfonylethylamino)isoindole-1,3-dione |
| SMILES | CCCS(=O)(=O)CCNc1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C14H18N2O4S/c1-3-7-21(19,20)8-6-15-10-4-5-11-12(9-10)14(18)16(2)13(11)17/h4-5,9,15H,3,6-8H2,1-2H3 |
| InChIKey | DGHQRVWLUXBDBA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|