C11H10N2O4 — CID 28897269
2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]acetic acid (PubChem CID 28897269) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]acetic acid.
| Compound Name | 2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]acetic acid |
|---|---|
| PubChem CID | 28897269 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]acetic acid |
| SMILES | CN1C(=O)c2ccc(NCC(=O)O)cc2C1=O |
| InChI | InChI=1S/C11H10N2O4/c1-13-10(16)7-3-2-6(12-5-9(14)15)4-8(7)11(13)17/h2-4,12H,5H2,1H3,(H,14,15) |
| InChIKey | JXAFOYHETGZXPJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|