C12H10N2O5 — CID 62230900
3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-3-oxopropanoic acid (PubChem CID 62230900) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-3-oxopropanoic acid.
| Compound Name | 3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 62230900 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-3-oxopropanoic acid |
| SMILES | CN1C(=O)c2ccc(NC(=O)CC(=O)O)cc2C1=O |
| InChI | InChI=1S/C12H10N2O5/c1-14-11(18)7-3-2-6(4-8(7)12(14)19)13-9(15)5-10(16)17/h2-4H,5H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | SMIMPPHOCDKQMD-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|