C14H23BrN2 — CID 107572142
N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine (PubChem CID 107572142) has the molecular formula C14H23BrN2 and a molecular weight of 299.26 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine |
|---|---|
| PubChem CID | 107572142 |
| Molecular Formula | C14H23BrN2 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine |
| SMILES | Cc1cc(NCCNC(C)(C)C)cc(C)c1Br |
| InChI | InChI=1S/C14H23BrN2/c1-10-8-12(9-11(2)13(10)15)16-6-7-17-14(3,4)5/h8-9,16-17H,6-7H2,1-5H3 |
| InChIKey | ZRYGZJLYMTZFKH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|