About N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine
N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine (PubChem CID 107572142) has the molecular formula C14H23BrN2
and a molecular weight of 299.26 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine |
| PubChem CID | 107572142 |
| Molecular Formula | C14H23BrN2 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine |
| SMILES | Cc1cc(NCCNC(C)(C)C)cc(C)c1Br |
| InChI | InChI=1S/C14H23BrN2/c1-10-8-12(9-11(2)13(10)15)16-6-7-17-14(3,4)5/h8-9,16-17H,6-7H2,1-5H3 |
| InChIKey | ZRYGZJLYMTZFKH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine?
The IUPAC name of N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine (CID 107572142) is N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine.
What is the SMILES notation for N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine?
The canonical SMILES for N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine is Cc1cc(NCCNC(C)(C)C)cc(C)c1Br.
What is the InChIKey of N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine?
The InChIKey is ZRYGZJLYMTZFKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23BrN2/c1-10-8-12(9-11(2)13(10)15)16-6-7-17-14(3,4)5/h8-9,16-17H,6-7H2,1-5H3.
What are the key properties of N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine?
N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine has a molecular weight of 299.26 g/mol, XLogP of 3.87, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-3,5-dimethylphenyl)-N'-tert-butylethane-1,2-diamine is sourced from PubChem (CID 107572142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).