C14H25N3O2S — CID 107445229
N-[4-[2-(tert-butylamino)ethylamino]-2-methylphenyl]methanesulfonamide (PubChem CID 107445229) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is N-[4-[2-(tert-butylamino)ethylamino]-2-methylphenyl]methanesulfonamide.
| Compound Name | N-[4-[2-(tert-butylamino)ethylamino]-2-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 107445229 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | N-[4-[2-(tert-butylamino)ethylamino]-2-methylphenyl]methanesulfonamide |
| SMILES | Cc1cc(NCCNC(C)(C)C)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C14H25N3O2S/c1-11-10-12(15-8-9-16-14(2,3)4)6-7-13(11)17-20(5,18)19/h6-7,10,15-17H,8-9H2,1-5H3 |
| InChIKey | XMMCQWRBEVLTOA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|