C15H21BrN2 — CID 103579712
5-(4-bromo-3,5-dimethylanilino)-2,2-dimethylpentanenitrile (PubChem CID 103579712) has the molecular formula C15H21BrN2 and a molecular weight of 309.25 g/mol. Its IUPAC name is 5-(4-bromo-3,5-dimethylanilino)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(4-bromo-3,5-dimethylanilino)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 103579712 |
| Molecular Formula | C15H21BrN2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 5-(4-bromo-3,5-dimethylanilino)-2,2-dimethylpentanenitrile |
| SMILES | Cc1cc(NCCCC(C)(C)C#N)cc(C)c1Br |
| InChI | InChI=1S/C15H21BrN2/c1-11-8-13(9-12(2)14(11)16)18-7-5-6-15(3,4)10-17/h8-9,18H,5-7H2,1-4H3 |
| InChIKey | HUQBEAQXHZQWTG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|