C13H16Br2N2 — CID 65253982
5-(2,5-dibromoanilino)-2,2-dimethylpentanenitrile (PubChem CID 65253982) has the molecular formula C13H16Br2N2 and a molecular weight of 360.09 g/mol. Its IUPAC name is 5-(2,5-dibromoanilino)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(2,5-dibromoanilino)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65253982 |
| Molecular Formula | C13H16Br2N2 |
| Molecular Weight | 360.09 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 5-(2,5-dibromoanilino)-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCNc1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H16Br2N2/c1-13(2,9-16)6-3-7-17-12-8-10(14)4-5-11(12)15/h4-5,8,17H,3,6-7H2,1-2H3 |
| InChIKey | NJVVLUMXKQXJAI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.09 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|