C10H10Br2N2 — CID 61466960
3-(2,5-dibromoanilino)-2-methylpropanenitrile (PubChem CID 61466960) has the molecular formula C10H10Br2N2 and a molecular weight of 318.01 g/mol. Its IUPAC name is 3-(2,5-dibromoanilino)-2-methylpropanenitrile.
| Compound Name | 3-(2,5-dibromoanilino)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 61466960 |
| Molecular Formula | C10H10Br2N2 |
| Molecular Weight | 318.01 g/mol |
| Exact Mass | 315.92 |
| IUPAC Name | 3-(2,5-dibromoanilino)-2-methylpropanenitrile |
| SMILES | CC(C#N)CNc1cc(Br)ccc1Br |
| InChI | InChI=1S/C10H10Br2N2/c1-7(5-13)6-14-10-4-8(11)2-3-9(10)12/h2-4,7,14H,6H2,1H3 |
| InChIKey | VCCAIUQHIXFEDB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.01 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |