C8H6Br2N2 — CID 61473879
2-(2,4-dibromoanilino)acetonitrile (PubChem CID 61473879) has the molecular formula C8H6Br2N2 and a molecular weight of 289.96 g/mol. Its IUPAC name is 2-(2,4-dibromoanilino)acetonitrile.
| Compound Name | 2-(2,4-dibromoanilino)acetonitrile |
|---|---|
| PubChem CID | 61473879 |
| Molecular Formula | C8H6Br2N2 |
| Molecular Weight | 289.96 g/mol |
| Exact Mass | 287.89 |
| IUPAC Name | 2-(2,4-dibromoanilino)acetonitrile |
| SMILES | N#CCNc1ccc(Br)cc1Br |
| InChI | InChI=1S/C8H6Br2N2/c9-6-1-2-8(7(10)5-6)12-4-3-11/h1-2,5,12H,4H2 |
| InChIKey | RIXWPBDPPXMCHJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.96 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|