C11H13Br2N — CID 107899791
2,4-dibromo-N-(3-methylbut-2-enyl)aniline (PubChem CID 107899791) has the molecular formula C11H13Br2N and a molecular weight of 319.04 g/mol. Its IUPAC name is 2,4-dibromo-N-(3-methylbut-2-enyl)aniline.
| Compound Name | 2,4-dibromo-N-(3-methylbut-2-enyl)aniline |
|---|---|
| PubChem CID | 107899791 |
| Molecular Formula | C11H13Br2N |
| Molecular Weight | 319.04 g/mol |
| Exact Mass | 316.94 |
| IUPAC Name | 2,4-dibromo-N-(3-methylbut-2-enyl)aniline |
| SMILES | CC(C)=CCNc1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H13Br2N/c1-8(2)5-6-14-11-4-3-9(12)7-10(11)13/h3-5,7,14H,6H2,1-2H3 |
| InChIKey | JILOTSXUCSKIJG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.04 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|