C12H14BrClN2 — CID 82773340
3-[1-(4-bromo-2-chlorophenyl)ethylamino]-2-methylpropanenitrile (PubChem CID 82773340) has the molecular formula C12H14BrClN2 and a molecular weight of 301.62 g/mol. Its IUPAC name is 3-[1-(4-bromo-2-chlorophenyl)ethylamino]-2-methylpropanenitrile.
| Compound Name | 3-[1-(4-bromo-2-chlorophenyl)ethylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 82773340 |
| Molecular Formula | C12H14BrClN2 |
| Molecular Weight | 301.62 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 3-[1-(4-bromo-2-chlorophenyl)ethylamino]-2-methylpropanenitrile |
| SMILES | CC(C#N)CNC(C)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H14BrClN2/c1-8(6-15)7-16-9(2)11-4-3-10(13)5-12(11)14/h3-5,8-9,16H,7H2,1-2H3 |
| InChIKey | LPEYZCOZBMGBST-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |