C11H15BrClNO2S — CID 82773613
1-(4-bromo-2-chlorophenyl)-N-(2-methylsulfonylethyl)ethanamine (PubChem CID 82773613) has the molecular formula C11H15BrClNO2S and a molecular weight of 340.67 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-N-(2-methylsulfonylethyl)ethanamine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-N-(2-methylsulfonylethyl)ethanamine |
|---|---|
| PubChem CID | 82773613 |
| Molecular Formula | C11H15BrClNO2S |
| Molecular Weight | 340.67 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-N-(2-methylsulfonylethyl)ethanamine |
| SMILES | CC(NCCS(C)(=O)=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C11H15BrClNO2S/c1-8(14-5-6-17(2,15)16)10-4-3-9(12)7-11(10)13/h3-4,7-8,14H,5-6H2,1-2H3 |
| InChIKey | UFEFCSOWQXTDCQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.67 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |