C12H16N2O2 — CID 62648148
3-[1-(2,4-dihydroxyphenyl)ethylamino]-2-methylpropanenitrile (PubChem CID 62648148) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-[1-(2,4-dihydroxyphenyl)ethylamino]-2-methylpropanenitrile.
| Compound Name | 3-[1-(2,4-dihydroxyphenyl)ethylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 62648148 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 3-[1-(2,4-dihydroxyphenyl)ethylamino]-2-methylpropanenitrile |
| SMILES | CC(C#N)CNC(C)c1ccc(O)cc1O |
| InChI | InChI=1S/C12H16N2O2/c1-8(6-13)7-14-9(2)11-4-3-10(15)5-12(11)16/h3-5,8-9,14-16H,7H2,1-2H3 |
| InChIKey | WHMYYVDXOXNVOV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|