C13H21NO4 — CID 114099388
4-[1-(2,3-dimethoxypropylamino)ethyl]benzene-1,3-diol (PubChem CID 114099388) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 4-[1-(2,3-dimethoxypropylamino)ethyl]benzene-1,3-diol.
| Compound Name | 4-[1-(2,3-dimethoxypropylamino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 114099388 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 4-[1-(2,3-dimethoxypropylamino)ethyl]benzene-1,3-diol |
| SMILES | COCC(CNC(C)c1ccc(O)cc1O)OC |
| InChI | InChI=1S/C13H21NO4/c1-9(14-7-11(18-3)8-17-2)12-5-4-10(15)6-13(12)16/h4-6,9,11,14-16H,7-8H2,1-3H3 |
| InChIKey | RLGYJAXIPJBVGA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|