C14H21NO3 — CID 65105787
4-[1-[(1-hydroxycyclopentyl)methylamino]ethyl]benzene-1,3-diol (PubChem CID 65105787) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-[1-[(1-hydroxycyclopentyl)methylamino]ethyl]benzene-1,3-diol.
| Compound Name | 4-[1-[(1-hydroxycyclopentyl)methylamino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 65105787 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 4-[1-[(1-hydroxycyclopentyl)methylamino]ethyl]benzene-1,3-diol |
| SMILES | CC(NCC1(O)CCCC1)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H21NO3/c1-10(12-5-4-11(16)8-13(12)17)15-9-14(18)6-2-3-7-14/h4-5,8,10,15-18H,2-3,6-7,9H2,1H3 |
| InChIKey | BGMGUMRDZIOVBF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|