C8H7Br2F2N — CID 61467186
2,5-dibromo-N-(2,2-difluoroethyl)aniline (PubChem CID 61467186) has the molecular formula C8H7Br2F2N and a molecular weight of 314.95 g/mol. Its IUPAC name is 2,5-dibromo-N-(2,2-difluoroethyl)aniline.
| Compound Name | 2,5-dibromo-N-(2,2-difluoroethyl)aniline |
|---|---|
| PubChem CID | 61467186 |
| Molecular Formula | C8H7Br2F2N |
| Molecular Weight | 314.95 g/mol |
| Exact Mass | 312.89 |
| IUPAC Name | 2,5-dibromo-N-(2,2-difluoroethyl)aniline |
| SMILES | FC(F)CNc1cc(Br)ccc1Br |
| InChI | InChI=1S/C8H7Br2F2N/c9-5-1-2-6(10)7(3-5)13-4-8(11)12/h1-3,8,13H,4H2 |
| InChIKey | DFMWYOUBLUULML-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.95 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |