C8H7BrF3N — CID 107635577
2-bromo-N-(2,2-difluoroethyl)-5-fluoroaniline (PubChem CID 107635577) has the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. Its IUPAC name is 2-bromo-N-(2,2-difluoroethyl)-5-fluoroaniline.
| Compound Name | 2-bromo-N-(2,2-difluoroethyl)-5-fluoroaniline |
|---|---|
| PubChem CID | 107635577 |
| Molecular Formula | C8H7BrF3N |
| Molecular Weight | 254.05 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | 2-bromo-N-(2,2-difluoroethyl)-5-fluoroaniline |
| SMILES | Fc1ccc(Br)c(NCC(F)F)c1 |
| InChI | InChI=1S/C8H7BrF3N/c9-6-2-1-5(10)3-7(6)13-4-8(11)12/h1-3,8,13H,4H2 |
| InChIKey | ZAKOJWXGEUEKCG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.05 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |