C8H7F4N — CID 60922655
N-(2,2-difluoroethyl)-2,4-difluoroaniline (PubChem CID 60922655) has the molecular formula C8H7F4N and a molecular weight of 193.14 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2,4-difluoroaniline.
| Compound Name | N-(2,2-difluoroethyl)-2,4-difluoroaniline |
|---|---|
| PubChem CID | 60922655 |
| Molecular Formula | C8H7F4N |
| Molecular Weight | 193.14 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | N-(2,2-difluoroethyl)-2,4-difluoroaniline |
| SMILES | Fc1ccc(NCC(F)F)c(F)c1 |
| InChI | InChI=1S/C8H7F4N/c9-5-1-2-7(6(10)3-5)13-4-8(11)12/h1-3,8,13H,4H2 |
| InChIKey | ATVFNDVSDZDMLG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.14 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |