C10H13F2N3O — CID 77027484
3-(2,4-difluoroanilino)-N'-hydroxy-2-methylpropanimidamide (PubChem CID 77027484) has the molecular formula C10H13F2N3O and a molecular weight of 229.23 g/mol. Its IUPAC name is 3-(2,4-difluoroanilino)-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-(2,4-difluoroanilino)-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 77027484 |
| Molecular Formula | C10H13F2N3O |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 3-(2,4-difluoroanilino)-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CC(CNc1ccc(F)cc1F)C(N)=NO |
| InChI | InChI=1S/C10H13F2N3O/c1-6(10(13)15-16)5-14-9-3-2-7(11)4-8(9)12/h2-4,6,14,16H,5H2,1H3,(H2,13,15) |
| InChIKey | GMWPKOPJUXWKAC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|