C11H16F2N2 — CID 115203586
1-N-(2,4-difluorophenyl)pentane-1,4-diamine (PubChem CID 115203586) has the molecular formula C11H16F2N2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-N-(2,4-difluorophenyl)pentane-1,4-diamine.
| Compound Name | 1-N-(2,4-difluorophenyl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 115203586 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 1-N-(2,4-difluorophenyl)pentane-1,4-diamine |
| SMILES | CC(N)CCCNc1ccc(F)cc1F |
| InChI | InChI=1S/C11H16F2N2/c1-8(14)3-2-6-15-11-5-4-9(12)7-10(11)13/h4-5,7-8,15H,2-3,6,14H2,1H3 |
| InChIKey | OQKYIJDJVICEQL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|