C10H15F2N3 — CID 106127704
1-N-(3,5-difluoro-2-pyridinyl)pentane-1,4-diamine (PubChem CID 106127704) has the molecular formula C10H15F2N3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-N-(3,5-difluoro-2-pyridinyl)pentane-1,4-diamine.
| Compound Name | 1-N-(3,5-difluoro-2-pyridinyl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 106127704 |
| Molecular Formula | C10H15F2N3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1-N-(3,5-difluoro-2-pyridinyl)pentane-1,4-diamine |
| SMILES | CC(N)CCCNc1ncc(F)cc1F |
| InChI | InChI=1S/C10H15F2N3/c1-7(13)3-2-4-14-10-9(12)5-8(11)6-15-10/h5-7H,2-4,13H2,1H3,(H,14,15) |
| InChIKey | YWTUTAQVKWOUQZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|