C12H18F2N2O — CID 112675793
3,5-difluoro-N-[2-(3-methylbutoxy)ethyl]pyridin-2-amine (PubChem CID 112675793) has the molecular formula C12H18F2N2O and a molecular weight of 244.28 g/mol. Its IUPAC name is 3,5-difluoro-N-[2-(3-methylbutoxy)ethyl]pyridin-2-amine.
| Compound Name | 3,5-difluoro-N-[2-(3-methylbutoxy)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 112675793 |
| Molecular Formula | C12H18F2N2O |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 3,5-difluoro-N-[2-(3-methylbutoxy)ethyl]pyridin-2-amine |
| SMILES | CC(C)CCOCCNc1ncc(F)cc1F |
| InChI | InChI=1S/C12H18F2N2O/c1-9(2)3-5-17-6-4-15-12-11(14)7-10(13)8-16-12/h7-9H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | XQLGBDXMSWKRBP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|