C10H13ClF2N2O — CID 106243313
N-(3-chloro-4-methoxybutyl)-3,5-difluoropyridin-2-amine (PubChem CID 106243313) has the molecular formula C10H13ClF2N2O and a molecular weight of 250.68 g/mol. Its IUPAC name is N-(3-chloro-4-methoxybutyl)-3,5-difluoropyridin-2-amine.
| Compound Name | N-(3-chloro-4-methoxybutyl)-3,5-difluoropyridin-2-amine |
|---|---|
| PubChem CID | 106243313 |
| Molecular Formula | C10H13ClF2N2O |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | N-(3-chloro-4-methoxybutyl)-3,5-difluoropyridin-2-amine |
| SMILES | COCC(Cl)CCNc1ncc(F)cc1F |
| InChI | InChI=1S/C10H13ClF2N2O/c1-16-6-7(11)2-3-14-10-9(13)4-8(12)5-15-10/h4-5,7H,2-3,6H2,1H3,(H,14,15) |
| InChIKey | FUISYFTXWXNKJW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|