C8H11F2N3O2S — CID 112675620
N-[2-[(3,5-difluoro-2-pyridinyl)amino]ethyl]methanesulfonamide (PubChem CID 112675620) has the molecular formula C8H11F2N3O2S and a molecular weight of 251.26 g/mol. Its IUPAC name is N-[2-[(3,5-difluoro-2-pyridinyl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(3,5-difluoro-2-pyridinyl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 112675620 |
| Molecular Formula | C8H11F2N3O2S |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | N-[2-[(3,5-difluoro-2-pyridinyl)amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1ncc(F)cc1F |
| InChI | InChI=1S/C8H11F2N3O2S/c1-16(14,15)13-3-2-11-8-7(10)4-6(9)5-12-8/h4-5,13H,2-3H2,1H3,(H,11,12) |
| InChIKey | LVVCYGCGFJURGY-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|