C9H11ClF3N3O2S — CID 3847361
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]methanesulfonamide (PubChem CID 3847361) has the molecular formula C9H11ClF3N3O2S and a molecular weight of 317.72 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 3847361 |
| Molecular Formula | C9H11ClF3N3O2S |
| Molecular Weight | 317.72 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H11ClF3N3O2S/c1-19(17,18)16-3-2-14-8-7(10)4-6(5-15-8)9(11,12)13/h4-5,16H,2-3H2,1H3,(H,14,15) |
| InChIKey | SAMQBRCYETZYQM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.72 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|