C13H19ClF3N3 — CID 158421332
N'-tert-butyl-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propane-1,3-diamine (PubChem CID 158421332) has the molecular formula C13H19ClF3N3 and a molecular weight of 309.76 g/mol. Its IUPAC name is N'-tert-butyl-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propane-1,3-diamine.
| Compound Name | N'-tert-butyl-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 158421332 |
| Molecular Formula | C13H19ClF3N3 |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N'-tert-butyl-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propane-1,3-diamine |
| SMILES | CC(C)(C)NCCCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H19ClF3N3/c1-12(2,3)20-6-4-5-18-11-10(14)7-9(8-19-11)13(15,16)17/h7-8,20H,4-6H2,1-3H3,(H,18,19) |
| InChIKey | YAPZJCGZGGBIPQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|