C14H14ClF3N4 — CID 2783012
2-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzene-1,2-diamine (PubChem CID 2783012) has the molecular formula C14H14ClF3N4 and a molecular weight of 330.74 g/mol. Its IUPAC name is 2-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzene-1,2-diamine.
| Compound Name | 2-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 2783012 |
| Molecular Formula | C14H14ClF3N4 |
| Molecular Weight | 330.74 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzene-1,2-diamine |
| SMILES | Nc1ccccc1NCCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H14ClF3N4/c15-10-7-9(14(16,17)18)8-22-13(10)21-6-5-20-12-4-2-1-3-11(12)19/h1-4,7-8,20H,5-6,19H2,(H,21,22) |
| InChIKey | SMSDUHQTFQPUBO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.74 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|