C16H16Cl2F3N5 — CID 169367074
2-chloro-N'-[2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]phenyl]ethanimidamide (PubChem CID 169367074) has the molecular formula C16H16Cl2F3N5 and a molecular weight of 406.24 g/mol. Its IUPAC name is 2-chloro-N'-[2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169367074 |
| Molecular Formula | C16H16Cl2F3N5 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 2-chloro-N'-[2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]phenyl]ethanimidamide |
| SMILES | N/C(CCl)=N/c1ccccc1NCCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C16H16Cl2F3N5/c17-8-14(22)26-13-4-2-1-3-12(13)23-5-6-24-15-11(18)7-10(9-25-15)16(19,20)21/h1-4,7,9,23H,5-6,8H2,(H2,22,26)(H,24,25) |
| InChIKey | FFNSKNWXHQNDPW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|