C9H9ClF3N3O2 — CID 83204495
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl carbamate (PubChem CID 83204495) has the molecular formula C9H9ClF3N3O2 and a molecular weight of 283.64 g/mol. Its IUPAC name is 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl carbamate.
| Compound Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83204495 |
| Molecular Formula | C9H9ClF3N3O2 |
| Molecular Weight | 283.64 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H9ClF3N3O2/c10-6-3-5(9(11,12)13)4-16-7(6)15-1-2-18-8(14)17/h3-4H,1-2H2,(H2,14,17)(H,15,16) |
| InChIKey | NWGXATRVWSJDQI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.64 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|